About benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate
benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate (PubChem CID 145285342) has the molecular formula C17H25F3N2O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
| PubChem CID | 145285342 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(F)(F)F)CC1.c1ccccc1 |
| InChI | InChI=1S/C11H19F3N2O2.C6H6/c1-10(2,3)18-9(17)16-6-4-15(5-7-16)8-11(12,13)14;1-2-4-6-5-3-1/h4-8H2,1-3H3;1-6H |
| InChIKey | CBUPGAPHYGMFHR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
The IUPAC name of benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate (CID 145285342) is benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate.
What is the SMILES notation for benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
The canonical SMILES for benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(CC(F)(F)F)CC1.c1ccccc1.
What is the InChIKey of benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
The InChIKey is CBUPGAPHYGMFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O2.C6H6/c1-10(2,3)18-9(17)16-6-4-15(5-7-16)8-11(12,13)14;1-2-4-6-5-3-1/h4-8H2,1-3H3;1-6H.
What are the key properties of benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate?
benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate has a molecular weight of 346.39 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;tert-butyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate is sourced from PubChem (CID 145285342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).