C22H28N4O3S2 — CID 145285356
4-[(2S)-2-cyclohexyl-3,6-dihydro-2H-pyridin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 145285356) has the molecular formula C22H28N4O3S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 4-[(2S)-2-cyclohexyl-3,6-dihydro-2H-pyridin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | 4-[(2S)-2-cyclohexyl-3,6-dihydro-2H-pyridin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 145285356 |
| Molecular Formula | C22H28N4O3S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-[(2S)-2-cyclohexyl-3,6-dihydro-2H-pyridin-1-yl]-N-(1,2,4-thiadiazol-5-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1ccc2c(c1)OCCC2N1CC=CC[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C22H28N4O3S2/c27-31(28,25-22-23-15-24-30-22)17-9-10-18-20(11-13-29-21(18)14-17)26-12-5-4-8-19(26)16-6-2-1-3-7-16/h4-5,9-10,14-16,19-20H,1-3,6-8,11-13H2,(H,23,24,25)/t19-,20?/m0/s1 |
| InChIKey | KGHCVCLREZTGCM-XJDOXCRVSA-N |
| XLogP | 4.37 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|