C10H17F3N4 — CID 145285689
methanamine;2-(1H-pyrazol-5-yl)-4-(trifluoromethyl)piperidine (PubChem CID 145285689) has the molecular formula C10H17F3N4 and a molecular weight of 250.27 g/mol. Its IUPAC name is methanamine;2-(1H-pyrazol-5-yl)-4-(trifluoromethyl)piperidine.
| Compound Name | methanamine;2-(1H-pyrazol-5-yl)-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 145285689 |
| Molecular Formula | C10H17F3N4 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | methanamine;2-(1H-pyrazol-5-yl)-4-(trifluoromethyl)piperidine |
| SMILES | CN.FC(F)(F)C1CCNC(c2ccn[nH]2)C1 |
| InChI | InChI=1S/C9H12F3N3.CH5N/c10-9(11,12)6-1-3-13-8(5-6)7-2-4-14-15-7;1-2/h2,4,6,8,13H,1,3,5H2,(H,14,15);2H2,1H3 |
| InChIKey | HRVWPBZNNFIJKY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |