C22H32NO8P — CID 145286119
3-(3,4-dihydroxyphenyl)propyl 2-[3-(3,4-dihydroxyphenyl)propyl-dimethylazaniumyl]ethyl phosphate (PubChem CID 145286119) has the molecular formula C22H32NO8P and a molecular weight of 469.47 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)propyl 2-[3-(3,4-dihydroxyphenyl)propyl-dimethylazaniumyl]ethyl phosphate.
| Compound Name | 3-(3,4-dihydroxyphenyl)propyl 2-[3-(3,4-dihydroxyphenyl)propyl-dimethylazaniumyl]ethyl phosphate |
|---|---|
| PubChem CID | 145286119 |
| Molecular Formula | C22H32NO8P |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)propyl 2-[3-(3,4-dihydroxyphenyl)propyl-dimethylazaniumyl]ethyl phosphate |
| SMILES | C[N+](C)(CCCc1ccc(O)c(O)c1)CCOP(=O)([O-])OCCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H32NO8P/c1-23(2,11-3-5-17-7-9-19(24)21(26)15-17)12-14-31-32(28,29)30-13-4-6-18-8-10-20(25)22(27)16-18/h7-10,15-16H,3-6,11-14H2,1-2H3,(H4-,24,25,26,27,28,29) |
| InChIKey | DMJZDAAIKAEKTE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|