About 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine
4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine (PubChem CID 145286224) has the molecular formula C19H21F3N4O
and a molecular weight of 378.40 g/mol. Its IUPAC name is 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine.
Molecular Properties
| Compound Name | 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine |
| PubChem CID | 145286224 |
| Molecular Formula | C19H21F3N4O |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine |
| SMILES | CC(N)CC(C)COc1ccc(-c2cnn3cccnc23)cc1C(F)(F)F |
| InChI | InChI=1S/C19H21F3N4O/c1-12(8-13(2)23)11-27-17-5-4-14(9-16(17)19(20,21)22)15-10-25-26-7-3-6-24-18(15)26/h3-7,9-10,12-13H,8,11,23H2,1-2H3 |
| InChIKey | DSXJMTOGSFBPSB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
The IUPAC name of 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine (CID 145286224) is 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine.
What is the SMILES notation for 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
The canonical SMILES for 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine is CC(N)CC(C)COc1ccc(-c2cnn3cccnc23)cc1C(F)(F)F.
What is the InChIKey of 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
The InChIKey is DSXJMTOGSFBPSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3N4O/c1-12(8-13(2)23)11-27-17-5-4-14(9-16(17)19(20,21)22)15-10-25-26-7-3-6-24-18(15)26/h3-7,9-10,12-13H,8,11,23H2,1-2H3.
What are the key properties of 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine?
4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine has a molecular weight of 378.40 g/mol, XLogP of 4.17, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-[4-pyrazolo[1,5-a]pyrimidin-3-yl-2-(trifluoromethyl)phenoxy]pentan-2-amine is sourced from PubChem (CID 145286224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).