About 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine
4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine (PubChem CID 145286257) has the molecular formula C20H24FN3O
and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine |
| PubChem CID | 145286257 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine |
| SMILES | CC(C)C[C@@H](C)COc1ccc(-c2ccnc3c2cnn3C)cc1F |
| InChI | InChI=1S/C20H24FN3O/c1-13(2)9-14(3)12-25-19-6-5-15(10-18(19)21)16-7-8-22-20-17(16)11-23-24(20)4/h5-8,10-11,13-14H,9,12H2,1-4H3/t14-/m1/s1 |
| InChIKey | NKMRHCBSZMRAEP-CQSZACIVSA-N |
| XLogP | 4.84 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine?
The IUPAC name of 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine (CID 145286257) is 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine.
What is the SMILES notation for 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine?
The canonical SMILES for 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine is CC(C)C[C@@H](C)COc1ccc(-c2ccnc3c2cnn3C)cc1F.
What is the InChIKey of 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine?
The InChIKey is NKMRHCBSZMRAEP-CQSZACIVSA-N. The full InChI is InChI=1S/C20H24FN3O/c1-13(2)9-14(3)12-25-19-6-5-15(10-18(19)21)16-7-8-22-20-17(16)11-23-24(20)4/h5-8,10-11,13-14H,9,12H2,1-4H3/t14-/m1/s1.
What are the key properties of 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine?
4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine has a molecular weight of 341.43 g/mol, XLogP of 4.84, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2R)-2,4-dimethylpentoxy]-3-fluorophenyl]-1-methylpyrazolo[3,4-b]pyridine is sourced from PubChem (CID 145286257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).