About 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane
5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane (PubChem CID 145286848) has the molecular formula C10H17ClN2O
and a molecular weight of 216.71 g/mol. Its IUPAC name is 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane.
Molecular Properties
| Compound Name | 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane |
| PubChem CID | 145286848 |
| Molecular Formula | C10H17ClN2O |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane |
| SMILES | CC(C)C.Cc1nc(C)c(Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C6H7ClN2O.C4H10/c1-3-5(7)6(10)9-4(2)8-3;1-4(2)3/h1-2H3,(H,8,9,10);4H,1-3H3 |
| InChIKey | PKUCVMMBMZBKTJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane?
The IUPAC name of 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane (CID 145286848) is 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane.
What is the SMILES notation for 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane?
The canonical SMILES for 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane is CC(C)C.Cc1nc(C)c(Cl)c(=O)[nH]1.
What is the InChIKey of 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane?
The InChIKey is PKUCVMMBMZBKTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O.C4H10/c1-3-5(7)6(10)9-4(2)8-3;1-4(2)3/h1-2H3,(H,8,9,10);4H,1-3H3.
What are the key properties of 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane?
5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane has a molecular weight of 216.71 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4-dimethyl-1H-pyrimidin-6-one;2-methylpropane is sourced from PubChem (CID 145286848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).