C19H28N6O2 — CID 145286861
N',5-dimethyl-4-(7-methyl-2,7-diazaspiro[4.4]nonane-2-carbonyl)-N-[(Z)-4-oxobut-2-en-2-yl]pyrazole-1-carboximidamide (PubChem CID 145286861) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N',5-dimethyl-4-(7-methyl-2,7-diazaspiro[4.4]nonane-2-carbonyl)-N-[(Z)-4-oxobut-2-en-2-yl]pyrazole-1-carboximidamide.
| Compound Name | N',5-dimethyl-4-(7-methyl-2,7-diazaspiro[4.4]nonane-2-carbonyl)-N-[(Z)-4-oxobut-2-en-2-yl]pyrazole-1-carboximidamide |
|---|---|
| PubChem CID | 145286861 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | N',5-dimethyl-4-(7-methyl-2,7-diazaspiro[4.4]nonane-2-carbonyl)-N-[(Z)-4-oxobut-2-en-2-yl]pyrazole-1-carboximidamide |
| SMILES | C/N=C(\N/C(C)=C\C=O)n1ncc(C(=O)N2CCC3(CCN(C)C3)C2)c1C |
| InChI | InChI=1S/C19H28N6O2/c1-14(5-10-26)22-18(20-3)25-15(2)16(11-21-25)17(27)24-9-7-19(13-24)6-8-23(4)12-19/h5,10-11H,6-9,12-13H2,1-4H3,(H,20,22)/b14-5- |
| InChIKey | WLXIVQIIQIOMLZ-RZNTYIFUSA-N |
| XLogP | 0.89 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|