About ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one
ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one (PubChem CID 145286961) has the molecular formula C15H28F3NO2
and a molecular weight of 311.39 g/mol. Its IUPAC name is ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one |
| PubChem CID | 145286961 |
| Molecular Formula | C15H28F3NO2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one |
| SMILES | CC.COCC(C1CCN(C(=O)C(C)C)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H22F3NO2.C2H6/c1-9(2)12(18)17-6-4-10(5-7-17)11(8-19-3)13(14,15)16;1-2/h9-11H,4-8H2,1-3H3;1-2H3 |
| InChIKey | IBVUPMFQAFSCSZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one?
The IUPAC name of ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one (CID 145286961) is ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one.
What is the SMILES notation for ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one?
The canonical SMILES for ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one is CC.COCC(C1CCN(C(=O)C(C)C)CC1)C(F)(F)F.
What is the InChIKey of ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one?
The InChIKey is IBVUPMFQAFSCSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3NO2.C2H6/c1-9(2)12(18)17-6-4-10(5-7-17)11(8-19-3)13(14,15)16;1-2/h9-11H,4-8H2,1-3H3;1-2H3.
What are the key properties of ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one?
ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one has a molecular weight of 311.39 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-1-[4-(1,1,1-trifluoro-3-methoxypropan-2-yl)piperidin-1-yl]propan-1-one is sourced from PubChem (CID 145286961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).