About [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine
[4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine (PubChem CID 145286988) has the molecular formula C9H13F3N2
and a molecular weight of 206.21 g/mol. Its IUPAC name is [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine.
Molecular Properties
| Compound Name | [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine |
| PubChem CID | 145286988 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine |
| SMILES | [H]/N=C/N1CCC(C(=C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13F3N2/c1-7(9(10,11)12)8-2-4-14(6-13)5-3-8/h6,8,13H,1-5H2/b13-6+ |
| InChIKey | HLCDNRKEDABSGG-AWNIVKPZSA-N |
| XLogP | 2.42 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine?
The IUPAC name of [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine (CID 145286988) is [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine.
What is the SMILES notation for [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine?
The canonical SMILES for [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine is [H]/N=C/N1CCC(C(=C)C(F)(F)F)CC1.
What is the InChIKey of [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine?
The InChIKey is HLCDNRKEDABSGG-AWNIVKPZSA-N. The full InChI is InChI=1S/C9H13F3N2/c1-7(9(10,11)12)8-2-4-14(6-13)5-3-8/h6,8,13H,1-5H2/b13-6+.
What are the key properties of [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine?
[4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine has a molecular weight of 206.21 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]methanimine is sourced from PubChem (CID 145286988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).