C10H12FN3O — CID 145287045
2-butan-2-yl-7-fluoro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 145287045) has the molecular formula C10H12FN3O and a molecular weight of 209.22 g/mol. Its IUPAC name is 2-butan-2-yl-7-fluoro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-butan-2-yl-7-fluoro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 145287045 |
| Molecular Formula | C10H12FN3O |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-butan-2-yl-7-fluoro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CCC(C)c1nn2c(F)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C10H12FN3O/c1-3-6(2)9-12-10(15)7-4-5-8(11)14(7)13-9/h4-6H,3H2,1-2H3,(H,12,13,15) |
| InChIKey | NOHVBAZBHXUZRK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |