About ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one
ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one (PubChem CID 145287236) has the molecular formula C13H25F3N2O
and a molecular weight of 282.35 g/mol. Its IUPAC name is ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one |
| PubChem CID | 145287236 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one |
| SMILES | CC.CC(C)C(=O)N1CCN(CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H19F3N2O.C2H6/c1-9(2)10(17)16-7-5-15(6-8-16)4-3-11(12,13)14;1-2/h9H,3-8H2,1-2H3;1-2H3 |
| InChIKey | MKHNDJFQPMXKRL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one?
The IUPAC name of ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one (CID 145287236) is ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one.
What is the SMILES notation for ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one?
The canonical SMILES for ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one is CC.CC(C)C(=O)N1CCN(CCC(F)(F)F)CC1.
What is the InChIKey of ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one?
The InChIKey is MKHNDJFQPMXKRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O.C2H6/c1-9(2)10(17)16-7-5-15(6-8-16)4-3-11(12,13)14;1-2/h9H,3-8H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one?
ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one has a molecular weight of 282.35 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-1-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]propan-1-one is sourced from PubChem (CID 145287236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).