C17H20F3N5O2 — CID 145287345
3-[(E)-2-methanimidoyl-3-oxo-3-[4-(trifluoromethyl)piperidin-1-yl]prop-1-enyl]-4,6,7,8-tetrahydrocyclopenta[e][1,2,4]triazepin-5-one (PubChem CID 145287345) has the molecular formula C17H20F3N5O2 and a molecular weight of 383.37 g/mol. Its IUPAC name is 3-[(E)-2-methanimidoyl-3-oxo-3-[4-(trifluoromethyl)piperidin-1-yl]prop-1-enyl]-4,6,7,8-tetrahydrocyclopenta[e][1,2,4]triazepin-5-one.
| Compound Name | 3-[(E)-2-methanimidoyl-3-oxo-3-[4-(trifluoromethyl)piperidin-1-yl]prop-1-enyl]-4,6,7,8-tetrahydrocyclopenta[e][1,2,4]triazepin-5-one |
|---|---|
| PubChem CID | 145287345 |
| Molecular Formula | C17H20F3N5O2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-[(E)-2-methanimidoyl-3-oxo-3-[4-(trifluoromethyl)piperidin-1-yl]prop-1-enyl]-4,6,7,8-tetrahydrocyclopenta[e][1,2,4]triazepin-5-one |
| SMILES | [H]/N=C/C(=C\N1C=NC2=C(CCC2)C(=O)N1)C(=O)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H20F3N5O2/c18-17(19,20)12-4-6-24(7-5-12)16(27)11(8-21)9-25-10-22-14-3-1-2-13(14)15(26)23-25/h8-10,12,21H,1-7H2,(H,23,26)/b11-9+,21-8+ |
| InChIKey | JKZQANVIOHSBLN-NTHXNSFASA-N |
| XLogP | 2.13 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|