C17H29FN2 — CID 145287374
(Z)-4-[1-[4-(2-fluoropropan-2-yl)piperidin-1-yl]ethenyl]-N-methylhex-4-en-3-imine (PubChem CID 145287374) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is (Z)-4-[1-[4-(2-fluoropropan-2-yl)piperidin-1-yl]ethenyl]-N-methylhex-4-en-3-imine.
| Compound Name | (Z)-4-[1-[4-(2-fluoropropan-2-yl)piperidin-1-yl]ethenyl]-N-methylhex-4-en-3-imine |
|---|---|
| PubChem CID | 145287374 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | (Z)-4-[1-[4-(2-fluoropropan-2-yl)piperidin-1-yl]ethenyl]-N-methylhex-4-en-3-imine |
| SMILES | C=C(C(=C/C)/C(CC)=N/C)N1CCC(C(C)(C)F)CC1 |
| InChI | InChI=1S/C17H29FN2/c1-7-15(16(8-2)19-6)13(3)20-11-9-14(10-12-20)17(4,5)18/h7,14H,3,8-12H2,1-2,4-6H3/b15-7-,19-16+ |
| InChIKey | XIWRGBLAQSXGKT-RZQMNLBFSA-N |
| XLogP | 4.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|