C9H11F6NO — CID 145287462
1-[3,5-bis(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 145287462) has the molecular formula C9H11F6NO and a molecular weight of 263.18 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[3,5-bis(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 145287462 |
| Molecular Formula | C9H11F6NO |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H11F6NO/c1-5(17)16-3-6(8(10,11)12)2-7(4-16)9(13,14)15/h6-7H,2-4H2,1H3 |
| InChIKey | MVXCVTGONZZTAN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |