About 1H-pyridine-2-thione;4-sulfanylbutanoic acid
1H-pyridine-2-thione;4-sulfanylbutanoic acid (PubChem CID 145287528) has the molecular formula C9H13NO2S2
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1H-pyridine-2-thione;4-sulfanylbutanoic acid.
Molecular Properties
| Compound Name | 1H-pyridine-2-thione;4-sulfanylbutanoic acid |
| PubChem CID | 145287528 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 1H-pyridine-2-thione;4-sulfanylbutanoic acid |
| SMILES | O=C(O)CCCS.S=c1cccc[nH]1 |
| InChI | InChI=1S/C5H5NS.C4H8O2S/c7-5-3-1-2-4-6-5;5-4(6)2-1-3-7/h1-4H,(H,6,7);7H,1-3H2,(H,5,6) |
| InChIKey | FIZQGOUEUJIIFY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyridine-2-thione;4-sulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyridine-2-thione;4-sulfanylbutanoic acid?
The IUPAC name of 1H-pyridine-2-thione;4-sulfanylbutanoic acid (CID 145287528) is 1H-pyridine-2-thione;4-sulfanylbutanoic acid.
What is the SMILES notation for 1H-pyridine-2-thione;4-sulfanylbutanoic acid?
The canonical SMILES for 1H-pyridine-2-thione;4-sulfanylbutanoic acid is O=C(O)CCCS.S=c1cccc[nH]1.
What is the InChIKey of 1H-pyridine-2-thione;4-sulfanylbutanoic acid?
The InChIKey is FIZQGOUEUJIIFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NS.C4H8O2S/c7-5-3-1-2-4-6-5;5-4(6)2-1-3-7/h1-4H,(H,6,7);7H,1-3H2,(H,5,6).
What are the key properties of 1H-pyridine-2-thione;4-sulfanylbutanoic acid?
1H-pyridine-2-thione;4-sulfanylbutanoic acid has a molecular weight of 231.34 g/mol, XLogP of 2.53, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyridine-2-thione;4-sulfanylbutanoic acid is sourced from PubChem (CID 145287528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).