About 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline
5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 14528785) has the molecular formula C10H12BrN
and a molecular weight of 226.12 g/mol. Its IUPAC name is 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 14528785 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCc2c(Br)cccc2C1 |
| InChI | InChI=1S/C10H12BrN/c1-12-6-5-9-8(7-12)3-2-4-10(9)11/h2-4H,5-7H2,1H3 |
| InChIKey | QEJKVWQQIKRFRM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline (CID 14528785) is 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline is CN1CCc2c(Br)cccc2C1.
What is the InChIKey of 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is QEJKVWQQIKRFRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN/c1-12-6-5-9-8(7-12)3-2-4-10(9)11/h2-4H,5-7H2,1H3.
What are the key properties of 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline?
5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 226.12 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 14528785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).