C18H29N5 — CID 145287984
N-[(Z,3Z)-2-(3,4-dihydropyridin-6-yl)-3-(ethylaminomethylimino)-1-(methylideneamino)prop-1-enyl]cyclohexanamine (PubChem CID 145287984) has the molecular formula C18H29N5 and a molecular weight of 315.47 g/mol. Its IUPAC name is N-[(Z,3Z)-2-(3,4-dihydropyridin-6-yl)-3-(ethylaminomethylimino)-1-(methylideneamino)prop-1-enyl]cyclohexanamine.
| Compound Name | N-[(Z,3Z)-2-(3,4-dihydropyridin-6-yl)-3-(ethylaminomethylimino)-1-(methylideneamino)prop-1-enyl]cyclohexanamine |
|---|---|
| PubChem CID | 145287984 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | N-[(Z,3Z)-2-(3,4-dihydropyridin-6-yl)-3-(ethylaminomethylimino)-1-(methylideneamino)prop-1-enyl]cyclohexanamine |
| SMILES | C=N/C(NC1CCCCC1)=C(\C=N/CNCC)C1=CCCC=N1 |
| InChI | InChI=1S/C18H29N5/c1-3-20-14-21-13-16(17-11-7-8-12-22-17)18(19-2)23-15-9-5-4-6-10-15/h11-13,15,20,23H,2-10,14H2,1H3/b18-16-,21-13- |
| InChIKey | CAYJOOCTBYLRPQ-ZDLDYDIASA-N |
| XLogP | 3.21 |
| TPSA | 61.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|