About propane;1-(2-propyltetrazol-5-yl)propan-1-ol
propane;1-(2-propyltetrazol-5-yl)propan-1-ol (PubChem CID 145288431) has the molecular formula C10H22N4O
and a molecular weight of 214.31 g/mol. Its IUPAC name is propane;1-(2-propyltetrazol-5-yl)propan-1-ol.
Molecular Properties
| Compound Name | propane;1-(2-propyltetrazol-5-yl)propan-1-ol |
| PubChem CID | 145288431 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | propane;1-(2-propyltetrazol-5-yl)propan-1-ol |
| SMILES | CCC.CCCn1nnc(C(O)CC)n1 |
| InChI | InChI=1S/C7H14N4O.C3H8/c1-3-5-11-9-7(8-10-11)6(12)4-2;1-3-2/h6,12H,3-5H2,1-2H3;3H2,1-2H3 |
| InChIKey | GFBMPFHWWMYMSP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propane;1-(2-propyltetrazol-5-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;1-(2-propyltetrazol-5-yl)propan-1-ol?
The IUPAC name of propane;1-(2-propyltetrazol-5-yl)propan-1-ol (CID 145288431) is propane;1-(2-propyltetrazol-5-yl)propan-1-ol.
What is the SMILES notation for propane;1-(2-propyltetrazol-5-yl)propan-1-ol?
The canonical SMILES for propane;1-(2-propyltetrazol-5-yl)propan-1-ol is CCC.CCCn1nnc(C(O)CC)n1.
What is the InChIKey of propane;1-(2-propyltetrazol-5-yl)propan-1-ol?
The InChIKey is GFBMPFHWWMYMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O.C3H8/c1-3-5-11-9-7(8-10-11)6(12)4-2;1-3-2/h6,12H,3-5H2,1-2H3;3H2,1-2H3.
What are the key properties of propane;1-(2-propyltetrazol-5-yl)propan-1-ol?
propane;1-(2-propyltetrazol-5-yl)propan-1-ol has a molecular weight of 214.31 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propane;1-(2-propyltetrazol-5-yl)propan-1-ol is sourced from PubChem (CID 145288431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).