About 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide
2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide (PubChem CID 145288536) has the molecular formula C17H17BrN2O2
and a molecular weight of 361.24 g/mol. Its IUPAC name is 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide.
Molecular Properties
| Compound Name | 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide |
| PubChem CID | 145288536 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide |
| SMILES | Cc1c2c(n(-c3ccc(C(N)=O)c(Br)c3)c1C)CCCC2=O |
| InChI | InChI=1S/C17H17BrN2O2/c1-9-10(2)20(14-4-3-5-15(21)16(9)14)11-6-7-12(17(19)22)13(18)8-11/h6-8H,3-5H2,1-2H3,(H2,19,22) |
| InChIKey | AARKZDSKTXHLBS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide?
The IUPAC name of 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide (CID 145288536) is 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide.
What is the SMILES notation for 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide?
The canonical SMILES for 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide is Cc1c2c(n(-c3ccc(C(N)=O)c(Br)c3)c1C)CCCC2=O.
What is the InChIKey of 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide?
The InChIKey is AARKZDSKTXHLBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrN2O2/c1-9-10(2)20(14-4-3-5-15(21)16(9)14)11-6-7-12(17(19)22)13(18)8-11/h6-8H,3-5H2,1-2H3,(H2,19,22).
What are the key properties of 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide?
2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide has a molecular weight of 361.24 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(2,3-dimethyl-4-oxo-6,7-dihydro-5H-indol-1-yl)benzamide is sourced from PubChem (CID 145288536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).