C13H18N2O7S — CID 145288547
[(2R,3S,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl N-(2-aminobenzoyl)sulfamate (PubChem CID 145288547) has the molecular formula C13H18N2O7S and a molecular weight of 346.36 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl N-(2-aminobenzoyl)sulfamate.
| Compound Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl N-(2-aminobenzoyl)sulfamate |
|---|---|
| PubChem CID | 145288547 |
| Molecular Formula | C13H18N2O7S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl N-(2-aminobenzoyl)sulfamate |
| SMILES | C[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccccc2N)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18N2O7S/c1-7-11(16)12(17)10(22-7)6-21-23(19,20)15-13(18)8-4-2-3-5-9(8)14/h2-5,7,10-12,16-17H,6,14H2,1H3,(H,15,18)/t7-,10+,11-,12+/m0/s1 |
| InChIKey | ROVRDDPYKUZBPF-FPQWWODTSA-N |
| XLogP | -1.23 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|