About 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene
2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene (PubChem CID 145288694) has the molecular formula C28H25O3P
and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene.
Molecular Properties
| Compound Name | 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene |
| PubChem CID | 145288694 |
| Molecular Formula | C28H25O3P |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene |
| SMILES | C=CCOc1cc(P(=O)(c2ccccc2)c2ccccc2)c(OCC=C)c2ccccc12 |
| InChI | InChI=1S/C28H25O3P/c1-3-19-30-26-21-27(28(31-20-4-2)25-18-12-11-17-24(25)26)32(29,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h3-18,21H,1-2,19-20H2 |
| InChIKey | SICGJHXACJWWRT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene?
The IUPAC name of 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene (CID 145288694) is 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene.
What is the SMILES notation for 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene?
The canonical SMILES for 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene is C=CCOc1cc(P(=O)(c2ccccc2)c2ccccc2)c(OCC=C)c2ccccc12.
What is the InChIKey of 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene?
The InChIKey is SICGJHXACJWWRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25O3P/c1-3-19-30-26-21-27(28(31-20-4-2)25-18-12-11-17-24(25)26)32(29,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h3-18,21H,1-2,19-20H2.
What are the key properties of 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene?
2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene has a molecular weight of 440.48 g/mol, XLogP of 5.61, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diphenylphosphoryl-1,4-bis(prop-2-enoxy)naphthalene is sourced from PubChem (CID 145288694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).