About N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide
N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide (PubChem CID 145289163) has the molecular formula C10H22N4O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide |
| PubChem CID | 145289163 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCCNC(=O)CNN |
| InChI | InChI=1S/C10H22N4O2/c1-10(2,3)6-8(15)12-4-5-13-9(16)7-14-11/h14H,4-7,11H2,1-3H3,(H,12,15)(H,13,16) |
| InChIKey | CBSMWWXFCJZELU-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide?
The IUPAC name of N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide (CID 145289163) is N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide.
What is the SMILES notation for N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide?
The canonical SMILES for N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide is CC(C)(C)CC(=O)NCCNC(=O)CNN.
What is the InChIKey of N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide?
The InChIKey is CBSMWWXFCJZELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4O2/c1-10(2,3)6-8(15)12-4-5-13-9(16)7-14-11/h14H,4-7,11H2,1-3H3,(H,12,15)(H,13,16).
What are the key properties of N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide?
N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide has a molecular weight of 230.31 g/mol, XLogP of -0.88, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2-hydrazinylacetyl)amino]ethyl]-3,3-dimethylbutanamide is sourced from PubChem (CID 145289163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).