C24H22F2N4O3 — CID 145290415
6-(3,5-difluoroanilino)-5-ethanimidoyl-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylic acid (PubChem CID 145290415) has the molecular formula C24H22F2N4O3 and a molecular weight of 452.46 g/mol. Its IUPAC name is 6-(3,5-difluoroanilino)-5-ethanimidoyl-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylic acid.
| Compound Name | 6-(3,5-difluoroanilino)-5-ethanimidoyl-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 145290415 |
| Molecular Formula | C24H22F2N4O3 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 6-(3,5-difluoroanilino)-5-ethanimidoyl-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylic acid |
| SMILES | [H]/N=C(\C)c1c(-c2ccc(N3CCOCC3)cc2)cc(C(=O)O)nc1Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H22F2N4O3/c1-14(27)22-20(15-2-4-19(5-3-15)30-6-8-33-9-7-30)13-21(24(31)32)29-23(22)28-18-11-16(25)10-17(26)12-18/h2-5,10-13,27H,6-9H2,1H3,(H,28,29)(H,31,32)/b27-14+ |
| InChIKey | BQJAXFLJIFSRBH-MZJWZYIUSA-N |
| XLogP | 4.69 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|