C29H38N6OS — CID 145290583
3-cyclobutyl-N-ethylsulfanyl-1-phenyl-4-(4-piperidin-1-ylpiperidin-1-yl)pyrazolo[5,4-b]pyridine-6-carboxamide (PubChem CID 145290583) has the molecular formula C29H38N6OS and a molecular weight of 518.73 g/mol. Its IUPAC name is 3-cyclobutyl-N-ethylsulfanyl-1-phenyl-4-(4-piperidin-1-ylpiperidin-1-yl)pyrazolo[5,4-b]pyridine-6-carboxamide.
| Compound Name | 3-cyclobutyl-N-ethylsulfanyl-1-phenyl-4-(4-piperidin-1-ylpiperidin-1-yl)pyrazolo[5,4-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 145290583 |
| Molecular Formula | C29H38N6OS |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 3-cyclobutyl-N-ethylsulfanyl-1-phenyl-4-(4-piperidin-1-ylpiperidin-1-yl)pyrazolo[5,4-b]pyridine-6-carboxamide |
| SMILES | CCSNC(=O)c1cc(N2CCC(N3CCCCC3)CC2)c2c(C3CCC3)nn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C29H38N6OS/c1-2-37-32-29(36)24-20-25(34-18-14-22(15-19-34)33-16-7-4-8-17-33)26-27(21-10-9-11-21)31-35(28(26)30-24)23-12-5-3-6-13-23/h3,5-6,12-13,20-22H,2,4,7-11,14-19H2,1H3,(H,32,36) |
| InChIKey | FBCIJWNYLTZIAB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|