C52H41NS — CID 145291546
4-[4-[2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2-yl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-phenyl-1,2-dihydropyridine (PubChem CID 145291546) has the molecular formula C52H41NS and a molecular weight of 711.97 g/mol. Its IUPAC name is 4-[4-[2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2-yl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-phenyl-1,2-dihydropyridine.
| Compound Name | 4-[4-[2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2-yl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-phenyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 145291546 |
| Molecular Formula | C52H41NS |
| Molecular Weight | 711.97 g/mol |
| Exact Mass | 711.30 |
| IUPAC Name | 4-[4-[2'-ethenyl-3'-[(Z)-prop-1-enyl]spiro[fluorene-9,4'-indeno[1,2-b]thiophene]-2-yl]phenyl]-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-phenyl-1,2-dihydropyridine |
| SMILES | C=C/C(=C\C=C/C)C1=CC(c2ccc(-c3ccc4c(c3)C3(c5ccccc5-4)c4ccccc4-c4sc(C=C)c(/C=C\C)c43)cc2)=CC(c2ccccc2)N1 |
| InChI | InChI=1S/C52H41NS/c1-5-9-18-34(7-3)47-32-39(33-48(53-47)37-19-11-10-12-20-37)36-27-25-35(26-28-36)38-29-30-41-40-21-13-15-23-44(40)52(46(41)31-38)45-24-16-14-22-42(45)51-50(52)43(17-6-2)49(8-4)54-51/h5-33,48,53H,3-4H2,1-2H3/b9-5-,17-6-,34-18+ |
| InChIKey | WLXPMVAQURQPGY-VHWVQBLYSA-N |
| XLogP | 13.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.97 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|