C21H18O3 — CID 14529191
1-(4-methoxyphenyl)-4-naphthalen-1-ylbutane-1,4-dione (PubChem CID 14529191) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-naphthalen-1-ylbutane-1,4-dione.
| Compound Name | 1-(4-methoxyphenyl)-4-naphthalen-1-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 14529191 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-naphthalen-1-ylbutane-1,4-dione |
| SMILES | COc1ccc(C(=O)CCC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C21H18O3/c1-24-17-11-9-16(10-12-17)20(22)13-14-21(23)19-8-4-6-15-5-2-3-7-18(15)19/h2-12H,13-14H2,1H3 |
| InChIKey | BDRVXGVQFAZOBW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |