C26H28ClN5O3 — CID 145292481
but-3-enyl (2S)-2-amino-4-[2-[4-(aminomethyl)phenyl]-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate (PubChem CID 145292481) has the molecular formula C26H28ClN5O3 and a molecular weight of 494.00 g/mol. Its IUPAC name is but-3-enyl (2S)-2-amino-4-[2-[4-(aminomethyl)phenyl]-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate.
| Compound Name | but-3-enyl (2S)-2-amino-4-[2-[4-(aminomethyl)phenyl]-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145292481 |
| Molecular Formula | C26H28ClN5O3 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | but-3-enyl (2S)-2-amino-4-[2-[4-(aminomethyl)phenyl]-4-chloroquinoline-7-carbonyl]piperazine-1-carboxylate |
| SMILES | C=CCCOC(=O)N1CCN(C(=O)c2ccc3c(Cl)cc(-c4ccc(CN)cc4)nc3c2)C[C@H]1N |
| InChI | InChI=1S/C26H28ClN5O3/c1-2-3-12-35-26(34)32-11-10-31(16-24(32)29)25(33)19-8-9-20-21(27)14-22(30-23(20)13-19)18-6-4-17(15-28)5-7-18/h2,4-9,13-14,24H,1,3,10-12,15-16,28-29H2/t24-/m0/s1 |
| InChIKey | SVQLQOWGSFUNLJ-DEOSSOPVSA-N |
| XLogP | 3.77 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|