C15H15ClN2 — CID 145292701
9-chloro-6-ethenyl-1,2,3,4-tetrahydroacridin-2-amine (PubChem CID 145292701) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 9-chloro-6-ethenyl-1,2,3,4-tetrahydroacridin-2-amine.
| Compound Name | 9-chloro-6-ethenyl-1,2,3,4-tetrahydroacridin-2-amine |
|---|---|
| PubChem CID | 145292701 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 9-chloro-6-ethenyl-1,2,3,4-tetrahydroacridin-2-amine |
| SMILES | C=Cc1ccc2c(Cl)c3c(nc2c1)CCC(N)C3 |
| InChI | InChI=1S/C15H15ClN2/c1-2-9-3-5-11-14(7-9)18-13-6-4-10(17)8-12(13)15(11)16/h2-3,5,7,10H,1,4,6,8,17H2 |
| InChIKey | KSHHCMXWWMIKHT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |