C15H19NO6 — CID 14529271
diethyl (3aR,7aR)-6-methyl-2,3-dioxo-4,7-dihydro-1H-indole-3a,7a-dicarboxylate (PubChem CID 14529271) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is diethyl (3aR,7aR)-6-methyl-2,3-dioxo-4,7-dihydro-1H-indole-3a,7a-dicarboxylate.
| Compound Name | diethyl (3aR,7aR)-6-methyl-2,3-dioxo-4,7-dihydro-1H-indole-3a,7a-dicarboxylate |
|---|---|
| PubChem CID | 14529271 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | diethyl (3aR,7aR)-6-methyl-2,3-dioxo-4,7-dihydro-1H-indole-3a,7a-dicarboxylate |
| SMILES | CCOC(=O)[C@]12CC=C(C)C[C@@]1(C(=O)OCC)NC(=O)C2=O |
| InChI | InChI=1S/C15H19NO6/c1-4-21-12(19)14-7-6-9(3)8-15(14,13(20)22-5-2)16-11(18)10(14)17/h6H,4-5,7-8H2,1-3H3,(H,16,18)/t14-,15+/m1/s1 |
| InChIKey | YCWRSISNTOFBAH-CABCVRRESA-N |
| XLogP | 0.28 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|