C25H37ClN6O3 — CID 145292733
propyl N-[2-[[9-chloro-6-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydroacridine-3-carbonyl]-(hydrazinylmethyl)amino]ethyl]carbamate (PubChem CID 145292733) has the molecular formula C25H37ClN6O3 and a molecular weight of 505.06 g/mol. Its IUPAC name is propyl N-[2-[[9-chloro-6-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydroacridine-3-carbonyl]-(hydrazinylmethyl)amino]ethyl]carbamate.
| Compound Name | propyl N-[2-[[9-chloro-6-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydroacridine-3-carbonyl]-(hydrazinylmethyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 145292733 |
| Molecular Formula | C25H37ClN6O3 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | propyl N-[2-[[9-chloro-6-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydroacridine-3-carbonyl]-(hydrazinylmethyl)amino]ethyl]carbamate |
| SMILES | CCCOC(=O)NCCN(CNN)C(=O)c1ccc2c(Cl)c3c(nc2c1)CC(CCN(C)C)CC3 |
| InChI | InChI=1S/C25H37ClN6O3/c1-4-13-35-25(34)28-10-12-32(16-29-27)24(33)18-6-8-20-22(15-18)30-21-14-17(9-11-31(2)3)5-7-19(21)23(20)26/h6,8,15,17,29H,4-5,7,9-14,16,27H2,1-3H3,(H,28,34) |
| InChIKey | LJLDGQPBTKJCJC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|