C19H34O2Si — CID 14529460
(1R,7S,10R)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,10-dimethyltricyclo[5.2.1.02,6]dec-2-en-4-ol (PubChem CID 14529460) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (1R,7S,10R)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,10-dimethyltricyclo[5.2.1.02,6]dec-2-en-4-ol.
| Compound Name | (1R,7S,10R)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,10-dimethyltricyclo[5.2.1.02,6]dec-2-en-4-ol |
|---|---|
| PubChem CID | 14529460 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (1R,7S,10R)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,10-dimethyltricyclo[5.2.1.02,6]dec-2-en-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)[C@H]2CC[C@]1(C)C1=CC(O)CC12 |
| InChI | InChI=1S/C19H34O2Si/c1-17(2,3)22(6,7)21-12-19(5)15-8-9-18(19,4)16-11-13(20)10-14(15)16/h11,13-15,20H,8-10,12H2,1-7H3/t13?,14?,15-,18+,19+/m0/s1 |
| InChIKey | UQUBBCCXUJNSNG-KEDMZRARSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|