About 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one
5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one (PubChem CID 145294698) has the molecular formula C9H9NO4S
and a molecular weight of 227.24 g/mol. Its IUPAC name is 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one |
| PubChem CID | 145294698 |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one |
| SMILES | COc1cc(OC)c2c(c1)C(=O)NS2=O |
| InChI | InChI=1S/C9H9NO4S/c1-13-5-3-6-8(7(4-5)14-2)15(12)10-9(6)11/h3-4H,1-2H3,(H,10,11) |
| InChIKey | PPURUEZSSDCIGI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one?
The IUPAC name of 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one (CID 145294698) is 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one?
The canonical SMILES for 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one is COc1cc(OC)c2c(c1)C(=O)NS2=O.
What is the InChIKey of 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one?
The InChIKey is PPURUEZSSDCIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4S/c1-13-5-3-6-8(7(4-5)14-2)15(12)10-9(6)11/h3-4H,1-2H3,(H,10,11).
What are the key properties of 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one?
5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one has a molecular weight of 227.24 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethoxy-1-oxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 145294698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).