About 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine
2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine (PubChem CID 145296491) has the molecular formula C8H9ClN4
and a molecular weight of 196.64 g/mol. Its IUPAC name is 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine.
Molecular Properties
| Compound Name | 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine |
| PubChem CID | 145296491 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine |
| SMILES | C=C(Cl)/C=C\C(=C)/N=C(\N)NC#N |
| InChI | InChI=1S/C8H9ClN4/c1-6(9)3-4-7(2)13-8(11)12-5-10/h3-4H,1-2H2,(H3,11,12,13)/b4-3- |
| InChIKey | SVKAIHIHHVCRQU-ARJAWSKDSA-N |
| XLogP | 1.19 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine?
The IUPAC name of 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine (CID 145296491) is 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine.
What is the SMILES notation for 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine?
The canonical SMILES for 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine is C=C(Cl)/C=C\C(=C)/N=C(\N)NC#N.
What is the InChIKey of 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine?
The InChIKey is SVKAIHIHHVCRQU-ARJAWSKDSA-N. The full InChI is InChI=1S/C8H9ClN4/c1-6(9)3-4-7(2)13-8(11)12-5-10/h3-4H,1-2H2,(H3,11,12,13)/b4-3-.
What are the key properties of 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine?
2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine has a molecular weight of 196.64 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3Z)-5-chlorohexa-1,3,5-trien-2-yl]-1-cyanoguanidine is sourced from PubChem (CID 145296491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).