About (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane
(4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane (PubChem CID 145296641) has the molecular formula C11H17NS
and a molecular weight of 195.33 g/mol. Its IUPAC name is (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane.
Molecular Properties
| Compound Name | (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane |
| PubChem CID | 145296641 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane |
| SMILES | C=c1snc(C)/c1=C/C=C\C.CC |
| InChI | InChI=1S/C9H11NS.C2H6/c1-4-5-6-9-7(2)10-11-8(9)3;1-2/h4-6H,3H2,1-2H3;1-2H3/b5-4-,9-6-; |
| InChIKey | QAXFSAHKYCYZPA-HRELPHSOSA-N |
| XLogP | 2.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane?
The IUPAC name of (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane (CID 145296641) is (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane.
What is the SMILES notation for (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane?
The canonical SMILES for (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane is C=c1snc(C)/c1=C/C=C\C.CC.
What is the InChIKey of (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane?
The InChIKey is QAXFSAHKYCYZPA-HRELPHSOSA-N. The full InChI is InChI=1S/C9H11NS.C2H6/c1-4-5-6-9-7(2)10-11-8(9)3;1-2/h4-6H,3H2,1-2H3;1-2H3/b5-4-,9-6-;.
What are the key properties of (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane?
(4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane has a molecular weight of 195.33 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(Z)-but-2-enylidene]-3-methyl-5-methylidene-1,2-thiazole;ethane is sourced from PubChem (CID 145296641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).