About chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol
chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol (PubChem CID 145296675) has the molecular formula C15H19Cl2N3O
and a molecular weight of 328.24 g/mol. Its IUPAC name is chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol.
Molecular Properties
| Compound Name | chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol |
| PubChem CID | 145296675 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol |
| SMILES | CNc1nc(Cl)nc2c1CCC2.CO.Clc1ccccc1 |
| InChI | InChI=1S/C8H10ClN3.C6H5Cl.CH4O/c1-10-7-5-3-2-4-6(5)11-8(9)12-7;7-6-4-2-1-3-5-6;1-2/h2-4H2,1H3,(H,10,11,12);1-5H;2H,1H3 |
| InChIKey | RTOFFDJSOACKQK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol?
The IUPAC name of chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol (CID 145296675) is chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol.
What is the SMILES notation for chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol?
The canonical SMILES for chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol is CNc1nc(Cl)nc2c1CCC2.CO.Clc1ccccc1.
What is the InChIKey of chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol?
The InChIKey is RTOFFDJSOACKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3.C6H5Cl.CH4O/c1-10-7-5-3-2-4-6(5)11-8(9)12-7;7-6-4-2-1-3-5-6;1-2/h2-4H2,1H3,(H,10,11,12);1-5H;2H,1H3.
What are the key properties of chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol?
chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol has a molecular weight of 328.24 g/mol, XLogP of 3.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;2-chloro-N-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine;methanol is sourced from PubChem (CID 145296675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).