C17H17F3N4O2 — CID 145296858
1-[[3-(3-oxopropyl)phenyl]methyl]-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxamide (PubChem CID 145296858) has the molecular formula C17H17F3N4O2 and a molecular weight of 366.34 g/mol. Its IUPAC name is 1-[[3-(3-oxopropyl)phenyl]methyl]-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxamide.
| Compound Name | 1-[[3-(3-oxopropyl)phenyl]methyl]-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxamide |
|---|---|
| PubChem CID | 145296858 |
| Molecular Formula | C17H17F3N4O2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-[[3-(3-oxopropyl)phenyl]methyl]-6-(trifluoromethyl)-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxamide |
| SMILES | NC(=O)c1c(C(F)(F)F)nn2c1N(Cc1cccc(CCC=O)c1)CC2 |
| InChI | InChI=1S/C17H17F3N4O2/c18-17(19,20)14-13(15(21)26)16-23(6-7-24(16)22-14)10-12-4-1-3-11(9-12)5-2-8-25/h1,3-4,8-9H,2,5-7,10H2,(H2,21,26) |
| InChIKey | BWNVVKHCKQHZQS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|