About but-1-ene;ethane;N-methylpropan-2-imine
but-1-ene;ethane;N-methylpropan-2-imine (PubChem CID 145296976) has the molecular formula C10H23N
and a molecular weight of 157.30 g/mol. Its IUPAC name is but-1-ene;ethane;N-methylpropan-2-imine.
Molecular Properties
| Compound Name | but-1-ene;ethane;N-methylpropan-2-imine |
| PubChem CID | 145296976 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | but-1-ene;ethane;N-methylpropan-2-imine |
| SMILES | C=CCC.CC.CN=C(C)C |
| InChI | InChI=1S/C4H9N.C4H8.C2H6/c1-4(2)5-3;1-3-4-2;1-2/h1-3H3;3H,1,4H2,2H3;1-2H3 |
| InChIKey | PCOPZCJATDSKRZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;ethane;N-methylpropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;ethane;N-methylpropan-2-imine?
The IUPAC name of but-1-ene;ethane;N-methylpropan-2-imine (CID 145296976) is but-1-ene;ethane;N-methylpropan-2-imine.
What is the SMILES notation for but-1-ene;ethane;N-methylpropan-2-imine?
The canonical SMILES for but-1-ene;ethane;N-methylpropan-2-imine is C=CCC.CC.CN=C(C)C.
What is the InChIKey of but-1-ene;ethane;N-methylpropan-2-imine?
The InChIKey is PCOPZCJATDSKRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.C4H8.C2H6/c1-4(2)5-3;1-3-4-2;1-2/h1-3H3;3H,1,4H2,2H3;1-2H3.
What are the key properties of but-1-ene;ethane;N-methylpropan-2-imine?
but-1-ene;ethane;N-methylpropan-2-imine has a molecular weight of 157.30 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;ethane;N-methylpropan-2-imine is sourced from PubChem (CID 145296976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).