C16H25Cl — CID 145296991
(2Z,4Z,6Z)-5-[(Z)-4-chloropent-2-en-3-yl]-4-ethylnona-2,4,6-triene (PubChem CID 145296991) has the molecular formula C16H25Cl and a molecular weight of 252.83 g/mol. Its IUPAC name is (2Z,4Z,6Z)-5-[(Z)-4-chloropent-2-en-3-yl]-4-ethylnona-2,4,6-triene.
| Compound Name | (2Z,4Z,6Z)-5-[(Z)-4-chloropent-2-en-3-yl]-4-ethylnona-2,4,6-triene |
|---|---|
| PubChem CID | 145296991 |
| Molecular Formula | C16H25Cl |
| Molecular Weight | 252.83 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2Z,4Z,6Z)-5-[(Z)-4-chloropent-2-en-3-yl]-4-ethylnona-2,4,6-triene |
| SMILES | C/C=C\C(CC)=C(\C=C/CC)C(=C/C)/C(C)Cl |
| InChI | InChI=1S/C16H25Cl/c1-6-10-12-16(14(8-3)11-7-2)15(9-4)13(5)17/h7,9-13H,6,8H2,1-5H3/b11-7-,12-10-,15-9+,16-14- |
| InChIKey | BFLBSCRWMBYFKI-BHJZCCIMSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.83 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|