C18H30N2O — CID 145297317
1-butyl-N-[(3E)-2,4-dimethylhexa-1,3,5-trien-3-yl]piperidine-2-carboxamide (PubChem CID 145297317) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-butyl-N-[(3E)-2,4-dimethylhexa-1,3,5-trien-3-yl]piperidine-2-carboxamide.
| Compound Name | 1-butyl-N-[(3E)-2,4-dimethylhexa-1,3,5-trien-3-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 145297317 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 1-butyl-N-[(3E)-2,4-dimethylhexa-1,3,5-trien-3-yl]piperidine-2-carboxamide |
| SMILES | C=C/C(C)=C(/NC(=O)C1CCCCN1CCCC)C(=C)C |
| InChI | InChI=1S/C18H30N2O/c1-6-8-12-20-13-10-9-11-16(20)18(21)19-17(14(3)4)15(5)7-2/h7,16H,2-3,6,8-13H2,1,4-5H3,(H,19,21)/b17-15+ |
| InChIKey | PGTBIFKRPCBHAT-BMRADRMJSA-N |
| XLogP | 3.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|