C20H26N4O3S — CID 145297532
6-(1,5-dimethyl-6-oxo-3-pyridinyl)-N-hexylimidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 145297532) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 6-(1,5-dimethyl-6-oxo-3-pyridinyl)-N-hexylimidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 6-(1,5-dimethyl-6-oxo-3-pyridinyl)-N-hexylimidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 145297532 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 6-(1,5-dimethyl-6-oxo-3-pyridinyl)-N-hexylimidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CCCCCCNS(=O)(=O)c1cnc2ccc(-c3cc(C)c(=O)n(C)c3)cn12 |
| InChI | InChI=1S/C20H26N4O3S/c1-4-5-6-7-10-22-28(26,27)19-12-21-18-9-8-16(14-24(18)19)17-11-15(2)20(25)23(3)13-17/h8-9,11-14,22H,4-7,10H2,1-3H3 |
| InChIKey | UKSNUAAMVMHAFZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|