About 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane
2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane (PubChem CID 145297769) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane |
| PubChem CID | 145297769 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane |
| SMILES | CC1(C)CNCC2(CCCNCC2)O1 |
| InChI | InChI=1S/C11H22N2O/c1-10(2)8-13-9-11(14-10)4-3-6-12-7-5-11/h12-13H,3-9H2,1-2H3 |
| InChIKey | KNLVCUIKRMLUKV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane?
The IUPAC name of 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane (CID 145297769) is 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane.
What is the SMILES notation for 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane?
The canonical SMILES for 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane is CC1(C)CNCC2(CCCNCC2)O1.
What is the InChIKey of 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane?
The InChIKey is KNLVCUIKRMLUKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O/c1-10(2)8-13-9-11(14-10)4-3-6-12-7-5-11/h12-13H,3-9H2,1-2H3.
What are the key properties of 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane?
2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane has a molecular weight of 198.31 g/mol, XLogP of 0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1-oxa-4,10-diazaspiro[5.6]dodecane is sourced from PubChem (CID 145297769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).