C12H14N2O2 — CID 14529778
1-(2,4-dimethylphenyl)-1,3-diazinane-2,4-dione (PubChem CID 14529778) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(2,4-dimethylphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 14529778 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-1,3-diazinane-2,4-dione |
| SMILES | Cc1ccc(N2CCC(=O)NC2=O)c(C)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-8-3-4-10(9(2)7-8)14-6-5-11(15)13-12(14)16/h3-4,7H,5-6H2,1-2H3,(H,13,15,16) |
| InChIKey | NAWIQBAIDIYLNF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |