About ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde
ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde (PubChem CID 145297899) has the molecular formula C24H31N5O
and a molecular weight of 405.55 g/mol. Its IUPAC name is ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde.
Molecular Properties
| Compound Name | ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde |
| PubChem CID | 145297899 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde |
| SMILES | CC.CN1CCNCC1.Cc1cncc(-c2cncc(-c3ccc(C=O)cc3)n2)c1 |
| InChI | InChI=1S/C17H13N3O.C5H12N2.C2H6/c1-12-6-15(8-18-7-12)17-10-19-9-16(20-17)14-4-2-13(11-21)3-5-14;1-7-4-2-6-3-5-7;1-2/h2-11H,1H3;6H,2-5H2,1H3;1-2H3 |
| InChIKey | GOFFUHMLNHXRBN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde?
The IUPAC name of ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde (CID 145297899) is ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde.
What is the SMILES notation for ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde?
The canonical SMILES for ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde is CC.CN1CCNCC1.Cc1cncc(-c2cncc(-c3ccc(C=O)cc3)n2)c1.
What is the InChIKey of ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde?
The InChIKey is GOFFUHMLNHXRBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O.C5H12N2.C2H6/c1-12-6-15(8-18-7-12)17-10-19-9-16(20-17)14-4-2-13(11-21)3-5-14;1-7-4-2-6-3-5-7;1-2/h2-11H,1H3;6H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde?
ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde has a molecular weight of 405.55 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylpiperazine;4-[6-(5-methyl-3-pyridinyl)pyrazin-2-yl]benzaldehyde is sourced from PubChem (CID 145297899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).