C10H16N2O3 — CID 145298096
ethane;methyl 2-(azetidin-3-yl)-1,3-oxazole-4-carboxylate (PubChem CID 145298096) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is ethane;methyl 2-(azetidin-3-yl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethane;methyl 2-(azetidin-3-yl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 145298096 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethane;methyl 2-(azetidin-3-yl)-1,3-oxazole-4-carboxylate |
| SMILES | CC.COC(=O)c1coc(C2CNC2)n1 |
| InChI | InChI=1S/C8H10N2O3.C2H6/c1-12-8(11)6-4-13-7(10-6)5-2-9-3-5;1-2/h4-5,9H,2-3H2,1H3;1-2H3 |
| InChIKey | NCNYBXBRVAOSMV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |