About ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane
ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane (PubChem CID 145298097) has the molecular formula C21H38N2OS
and a molecular weight of 366.62 g/mol. Its IUPAC name is ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane |
| PubChem CID | 145298097 |
| Molecular Formula | C21H38N2OS |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane |
| SMILES | CC.CCCCCCc1nc2ccccc2n1COCCS(C)(C)C |
| InChI | InChI=1S/C19H32N2OS.C2H6/c1-5-6-7-8-13-19-20-17-11-9-10-12-18(17)21(19)16-22-14-15-23(2,3)4;1-2/h9-12H,5-8,13-16H2,1-4H3;1-2H3 |
| InChIKey | WASODLKQOZLKDN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane?
The IUPAC name of ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane (CID 145298097) is ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane.
What is the SMILES notation for ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane?
The canonical SMILES for ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane is CC.CCCCCCc1nc2ccccc2n1COCCS(C)(C)C.
What is the InChIKey of ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane?
The InChIKey is WASODLKQOZLKDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2OS.C2H6/c1-5-6-7-8-13-19-20-17-11-9-10-12-18(17)21(19)16-22-14-15-23(2,3)4;1-2/h9-12H,5-8,13-16H2,1-4H3;1-2H3.
What are the key properties of ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane?
ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane has a molecular weight of 366.62 g/mol, XLogP of 5.85, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[(2-hexylbenzimidazol-1-yl)methoxy]ethyl-trimethyl-λ4-sulfane is sourced from PubChem (CID 145298097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).