N-(1-methylcyclohexyl)propanamide;molecular hydrogen

C10H21NO — CID 145298233

IUPACN-(1-methylcyclohexyl)propanamide;molecular hydrogen
SMILESCCC(=O)NC1(C)CCCCC1.[H][H]
InChIInChI=1S/C10H19NO.H2/c1-3-9(12)11-10(2)7-5-4-6-8-10;/h3-8H2,1-2H3,(H,11,12);1H
InChIKeyMCUOMVMGFZOVLL-UHFFFAOYSA-N
MW171.28 g/mol
LogP2.48
Rot. Bonds2

About N-(1-methylcyclohexyl)propanamide;molecular hydrogen

N-(1-methylcyclohexyl)propanamide;molecular hydrogen (PubChem CID 145298233) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is N-(1-methylcyclohexyl)propanamide;molecular hydrogen.

Molecular Properties

Compound NameN-(1-methylcyclohexyl)propanamide;molecular hydrogen
PubChem CID145298233
Molecular FormulaC10H21NO
Molecular Weight171.28 g/mol
Exact Mass171.16
IUPAC NameN-(1-methylcyclohexyl)propanamide;molecular hydrogen
SMILESCCC(=O)NC1(C)CCCCC1.[H][H]
InChIInChI=1S/C10H19NO.H2/c1-3-9(12)11-10(2)7-5-4-6-8-10;/h3-8H2,1-2H3,(H,11,12);1H
InChIKeyMCUOMVMGFZOVLL-UHFFFAOYSA-N
XLogP2.48
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.28
LogP ≤ 52.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze N-(1-methylcyclohexyl)propanamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(1-methylcyclohexyl)propanamide;molecular hydrogen?
The IUPAC name of N-(1-methylcyclohexyl)propanamide;molecular hydrogen (CID 145298233) is N-(1-methylcyclohexyl)propanamide;molecular hydrogen.
What is the SMILES notation for N-(1-methylcyclohexyl)propanamide;molecular hydrogen?
The canonical SMILES for N-(1-methylcyclohexyl)propanamide;molecular hydrogen is CCC(=O)NC1(C)CCCCC1.[H][H].
What is the InChIKey of N-(1-methylcyclohexyl)propanamide;molecular hydrogen?
The InChIKey is MCUOMVMGFZOVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.H2/c1-3-9(12)11-10(2)7-5-4-6-8-10;/h3-8H2,1-2H3,(H,11,12);1H.
What are the key properties of N-(1-methylcyclohexyl)propanamide;molecular hydrogen?
N-(1-methylcyclohexyl)propanamide;molecular hydrogen has a molecular weight of 171.28 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methylcyclohexyl)propanamide;molecular hydrogen is sourced from PubChem (CID 145298233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).