About 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene
2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 14529854) has the molecular formula C15H24O4S2
and a molecular weight of 332.49 g/mol. Its IUPAC name is 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene.
Molecular Properties
| Compound Name | 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene |
| PubChem CID | 14529854 |
| Molecular Formula | C15H24O4S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC(C)(C)S(=O)(=O)C1=C(S(=O)(=O)C(C)(C)C)C2C=CC1C2 |
| InChI | InChI=1S/C15H24O4S2/c1-14(2,3)20(16,17)12-10-7-8-11(9-10)13(12)21(18,19)15(4,5)6/h7-8,10-11H,9H2,1-6H3 |
| InChIKey | SSPISBWXCTYVRF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene?
The IUPAC name of 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene (CID 14529854) is 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene.
What is the SMILES notation for 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene?
The canonical SMILES for 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene is CC(C)(C)S(=O)(=O)C1=C(S(=O)(=O)C(C)(C)C)C2C=CC1C2.
What is the InChIKey of 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene?
The InChIKey is SSPISBWXCTYVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4S2/c1-14(2,3)20(16,17)12-10-7-8-11(9-10)13(12)21(18,19)15(4,5)6/h7-8,10-11H,9H2,1-6H3.
What are the key properties of 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene?
2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene has a molecular weight of 332.49 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(tert-butylsulfonyl)bicyclo[2.2.1]hepta-2,5-diene is sourced from PubChem (CID 14529854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).