C28H26F3N3O4 — CID 145298771
3-[(3S)-4'-(4-cyclopropylphenyl)-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 145298771) has the molecular formula C28H26F3N3O4 and a molecular weight of 525.53 g/mol. Its IUPAC name is 3-[(3S)-4'-(4-cyclopropylphenyl)-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[(3S)-4'-(4-cyclopropylphenyl)-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 145298771 |
| Molecular Formula | C28H26F3N3O4 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 3-[(3S)-4'-(4-cyclopropylphenyl)-6'-oxo-6-(4,4,4-trifluorobutoxy)spiro[1,2-dihydroindene-3,2'-1,3-dihydropyridine]-5'-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=C1N[C@@]2(CCc3cc(OCCCC(F)(F)F)ccc32)CC(c2ccc(C3CC3)cc2)=C1c1noc(=O)[nH]1 |
| InChI | InChI=1S/C28H26F3N3O4/c29-28(30,31)11-1-13-37-20-8-9-22-19(14-20)10-12-27(22)15-21(18-6-4-17(5-7-18)16-2-3-16)23(25(35)33-27)24-32-26(36)38-34-24/h4-9,14,16H,1-3,10-13,15H2,(H,33,35)(H,32,34,36)/t27-/m0/s1 |
| InChIKey | HPXHRKPUXYDEOY-MHZLTWQESA-N |
| XLogP | 5.23 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|