About (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide
(NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide (PubChem CID 145298779) has the molecular formula C13H14BrF2NOS
and a molecular weight of 350.23 g/mol. Its IUPAC name is (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide |
| PubChem CID | 145298779 |
| Molecular Formula | C13H14BrF2NOS |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C1/c2ccc(Br)cc2CC1(F)F |
| InChI | InChI=1S/C13H14BrF2NOS/c1-12(2,3)19(18)17-11-10-5-4-9(14)6-8(10)7-13(11,15)16/h4-6H,7H2,1-3H3/b17-11- |
| InChIKey | TVXATNPYYBZKEK-BOPFTXTBSA-N |
| XLogP | 3.89 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide?
The IUPAC name of (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide (CID 145298779) is (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide?
The canonical SMILES for (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide is CC(C)(C)S(=O)/N=C1/c2ccc(Br)cc2CC1(F)F.
What is the InChIKey of (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide?
The InChIKey is TVXATNPYYBZKEK-BOPFTXTBSA-N. The full InChI is InChI=1S/C13H14BrF2NOS/c1-12(2,3)19(18)17-11-10-5-4-9(14)6-8(10)7-13(11,15)16/h4-6H,7H2,1-3H3/b17-11-.
What are the key properties of (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide?
(NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide has a molecular weight of 350.23 g/mol, XLogP of 3.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(5-bromo-2,2-difluoro-3H-inden-1-ylidene)-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 145298779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).